C18H26ClNO — CID 114550401
2-(4-chlorophenyl)-N-(3,3-dimethylcyclopentyl)-3-methylbutanamide (PubChem CID 114550401) has the molecular formula C18H26ClNO and a molecular weight of 307.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(3,3-dimethylcyclopentyl)-3-methylbutanamide.
| Compound Name | 2-(4-chlorophenyl)-N-(3,3-dimethylcyclopentyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 114550401 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.87 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(3,3-dimethylcyclopentyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NC1CCC(C)(C)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO/c1-12(2)16(13-5-7-14(19)8-6-13)17(21)20-15-9-10-18(3,4)11-15/h5-8,12,15-16H,9-11H2,1-4H3,(H,20,21) |
| InChIKey | TWLGKUWQXDMRFQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |