C23H34ClN3O — CID 92653700
(2S)-2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)-N-cyclopentylacetamide (PubChem CID 92653700) has the molecular formula C23H34ClN3O and a molecular weight of 404.00 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)-N-cyclopentylacetamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 92653700 |
| Molecular Formula | C23H34ClN3O |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-2-(4-cyclohexylpiperazin-1-yl)-N-cyclopentylacetamide |
| SMILES | O=C(NC1CCCC1)[C@H](c1ccc(Cl)cc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34ClN3O/c24-19-12-10-18(11-13-19)22(23(28)25-20-6-4-5-7-20)27-16-14-26(15-17-27)21-8-2-1-3-9-21/h10-13,20-22H,1-9,14-17H2,(H,25,28)/t22-/m0/s1 |
| InChIKey | RHGCQWPTVAGFDS-QFIPXVFZSA-N |
| XLogP | 4.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |