C22H26ClN3O3 — CID 93156034
(2R)-2-(4-chlorophenyl)-N-cyclopentyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 93156034) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-N-cyclopentyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | (2R)-2-(4-chlorophenyl)-N-cyclopentyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 93156034 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-N-cyclopentyl-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | O=C(NC1CCCC1)[C@@H](c1ccc(Cl)cc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H26ClN3O3/c23-17-9-7-16(8-10-17)20(21(27)24-18-4-1-2-5-18)25-11-13-26(14-12-25)22(28)19-6-3-15-29-19/h3,6-10,15,18,20H,1-2,4-5,11-14H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | RNDLXJQTISHHMP-HXUWFJFHSA-N |
| XLogP | 3.49 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |