C15H20N4O4 — CID 112994619
1-cyclopropyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]urea (PubChem CID 112994619) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 112994619 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-cyclopropyl-3-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]urea |
| SMILES | O=C(NCC(=O)N1CCN(C(=O)c2ccco2)CC1)NC1CC1 |
| InChI | InChI=1S/C15H20N4O4/c20-13(10-16-15(22)17-11-3-4-11)18-5-7-19(8-6-18)14(21)12-2-1-9-23-12/h1-2,9,11H,3-8,10H2,(H2,16,17,22) |
| InChIKey | KCTJHXIKIZDQJP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |