C19H21N3O4 — CID 110807717
N-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide (PubChem CID 110807717) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110807717 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-[2-[4-(furan-2-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCCN(C(=O)c2ccco2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O4/c23-17(14-20-18(24)15-6-2-1-3-7-15)21-9-5-10-22(12-11-21)19(25)16-8-4-13-26-16/h1-4,6-8,13H,5,9-12,14H2,(H,20,24) |
| InChIKey | ZCRVFUTWENZJJS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |