C20H20BrN3O6 — CID 29154616
[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 29154616) has the molecular formula C20H20BrN3O6 and a molecular weight of 478.30 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 29154616 |
| Molecular Formula | C20H20BrN3O6 |
| Molecular Weight | 478.30 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)OCC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H20BrN3O6/c21-15-5-3-14(4-6-15)19(27)22-12-18(26)30-13-17(25)23-7-9-24(10-8-23)20(28)16-2-1-11-29-16/h1-6,11H,7-10,12-13H2,(H,22,27) |
| InChIKey | FCFFIXCJVDCIMA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |