C21H27BrN4O2 — CID 111166669
N-[2-(4-bromophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111166669) has the molecular formula C21H27BrN4O2 and a molecular weight of 447.38 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(4-bromophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111166669 |
| Molecular Formula | C21H27BrN4O2 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)(C)c1ccc(Br)cc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H27BrN4O2/c1-21(2,16-6-8-17(22)9-7-16)15-24-20(23-3)26-12-10-25(11-13-26)19(27)18-5-4-14-28-18/h4-9,14H,10-13,15H2,1-3H3,(H,23,24) |
| InChIKey | DGMKGRCKFZAPGN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|