C16H20BrIN4O2S — CID 111167920
N-[(5-bromothiophen-2-yl)methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111167920) has the molecular formula C16H20BrIN4O2S and a molecular weight of 539.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111167920 |
| Molecular Formula | C16H20BrIN4O2S |
| Molecular Weight | 539.24 g/mol |
| Exact Mass | 537.95 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)s1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C16H19BrN4O2S.HI/c1-18-16(19-11-12-4-5-14(17)24-12)21-8-6-20(7-9-21)15(22)13-3-2-10-23-13;/h2-5,10H,6-9,11H2,1H3,(H,18,19);1H |
| InChIKey | FINSKRQESONLRO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|