C19H25IN4O4S — CID 111166990
4-(furan-2-carbonyl)-N'-methyl-N-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111166990) has the molecular formula C19H25IN4O4S and a molecular weight of 532.40 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111166990 |
| Molecular Formula | C19H25IN4O4S |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[(4-methylsulfonylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(C)(=O)=O)cc1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C19H24N4O4S.HI/c1-20-19(21-14-15-5-7-16(8-6-15)28(2,25)26)23-11-9-22(10-12-23)18(24)17-4-3-13-27-17;/h3-8,13H,9-12,14H2,1-2H3,(H,20,21);1H |
| InChIKey | VALNOANWUNIXCB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|