C22H29IN6O3 — CID 111167040
4-(furan-2-carbonyl)-N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111167040) has the molecular formula C22H29IN6O3 and a molecular weight of 552.42 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111167040 |
| Molecular Formula | C22H29IN6O3 |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCNC(=O)C2)cc1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C22H28N6O3.HI/c1-23-22(27-12-10-26(11-13-27)21(30)19-3-2-14-31-19)25-15-17-4-6-18(7-5-17)28-9-8-24-20(29)16-28;/h2-7,14H,8-13,15-16H2,1H3,(H,23,25)(H,24,29);1H |
| InChIKey | XGFJZOUPOMYLMK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|