C24H25N5O4 — CID 38314914
N-[3-[[[4-(3-oxopiperazin-1-yl)phenyl]methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 38314914) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[3-[[[4-(3-oxopiperazin-1-yl)phenyl]methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[[4-(3-oxopiperazin-1-yl)phenyl]methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 38314914 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | N-[3-[[[4-(3-oxopiperazin-1-yl)phenyl]methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C1CN(c2ccc(CNC(=O)NCc3cccc(NC(=O)c4ccco4)c3)cc2)CCN1 |
| InChI | InChI=1S/C24H25N5O4/c30-22-16-29(11-10-25-22)20-8-6-17(7-9-20)14-26-24(32)27-15-18-3-1-4-19(13-18)28-23(31)21-5-2-12-33-21/h1-9,12-13H,10-11,14-16H2,(H,25,30)(H,28,31)(H2,26,27,32) |
| InChIKey | WTXMVWVTSQPZKW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|