C15H18N6O2S — CID 53498310
1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea (PubChem CID 53498310) has the molecular formula C15H18N6O2S and a molecular weight of 346.42 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea.
| Compound Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 53498310 |
| Molecular Formula | C15H18N6O2S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-(5-methyl-1,3,4-thiadiazol-2-yl)-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]urea |
| SMILES | Cc1nnc(NC(=O)NCc2ccc(N3CCNC(=O)C3)cc2)s1 |
| InChI | InChI=1S/C15H18N6O2S/c1-10-19-20-15(24-10)18-14(23)17-8-11-2-4-12(5-3-11)21-7-6-16-13(22)9-21/h2-5H,6-9H2,1H3,(H,16,22)(H2,17,18,20,23) |
| InChIKey | ZHDZABPCXKZAEH-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|