C23H30N6O — CID 110961657
N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide (PubChem CID 110961657) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961657 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | N'-methyl-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(N2CCNC(=O)C2)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N6O/c1-24-23(28-15-13-27(14-16-28)20-5-3-2-4-6-20)26-17-19-7-9-21(10-8-19)29-12-11-25-22(30)18-29/h2-10H,11-18H2,1H3,(H,24,26)(H,25,30) |
| InChIKey | OYCLOCVQQGLOAJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|