C27H32IN5O — CID 111356831
1-(2,2-diphenylethyl)-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111356831) has the molecular formula C27H32IN5O and a molecular weight of 569.49 g/mol. Its IUPAC name is 1-(2,2-diphenylethyl)-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-diphenylethyl)-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111356831 |
| Molecular Formula | C27H32IN5O |
| Molecular Weight | 569.49 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 1-(2,2-diphenylethyl)-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCNC(=O)C2)cc1)NCC(c1ccccc1)c1ccccc1.I |
| InChI | InChI=1S/C27H31N5O.HI/c1-28-27(30-18-21-12-14-24(15-13-21)32-17-16-29-26(33)20-32)31-19-25(22-8-4-2-5-9-22)23-10-6-3-7-11-23;/h2-15,25H,16-20H2,1H3,(H,29,33)(H2,28,30,31);1H |
| InChIKey | FHMGLAUJXCNHFL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|