C21H25F3IN5O — CID 111268306
2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111268306) has the molecular formula C21H25F3IN5O and a molecular weight of 547.36 g/mol. Its IUPAC name is 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111268306 |
| Molecular Formula | C21H25F3IN5O |
| Molecular Weight | 547.36 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCNC(=O)C2)cc1)NCc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C21H24F3N5O.HI/c1-25-20(28-13-16-3-2-4-17(11-16)21(22,23)24)27-12-15-5-7-18(8-6-15)29-10-9-26-19(30)14-29;/h2-8,11H,9-10,12-14H2,1H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | KNGHOUOTYSLZNQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|