C22H30IN5OS — CID 111677365
2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111677365) has the molecular formula C22H30IN5OS and a molecular weight of 539.49 g/mol. Its IUPAC name is 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111677365 |
| Molecular Formula | C22H30IN5OS |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCNC(=O)C2)cc1)NCC(C)Sc1ccccc1.I |
| InChI | InChI=1S/C22H29N5OS.HI/c1-17(29-20-6-4-3-5-7-20)14-25-22(23-2)26-15-18-8-10-19(11-9-18)27-13-12-24-21(28)16-27;/h3-11,17H,12-16H2,1-2H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | SOAARXWOWKOFAG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|