C21H27FIN5O — CID 111230520
1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111230520) has the molecular formula C21H27FIN5O and a molecular weight of 511.38 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111230520 |
| Molecular Formula | C21H27FIN5O |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1ccc(N2CCNC(=O)C2)cc1.I |
| InChI | InChI=1S/C21H26FN5O.HI/c1-23-21(25-11-10-16-2-6-18(22)7-3-16)26-14-17-4-8-19(9-5-17)27-13-12-24-20(28)15-27;/h2-9H,10-15H2,1H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | VFAJXHBPLYEPMO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|