C23H29IN6O — CID 110996742
1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110996742) has the molecular formula C23H29IN6O and a molecular weight of 532.43 g/mol. Its IUPAC name is 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110996742 |
| Molecular Formula | C23H29IN6O |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 1-[2-(1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1ccc(N2CCNC(=O)C2)cc1.I |
| InChI | InChI=1S/C23H28N6O.HI/c1-24-23(26-11-10-18-15-27-21-5-3-2-4-20(18)21)28-14-17-6-8-19(9-7-17)29-13-12-25-22(30)16-29;/h2-9,15,27H,10-14,16H2,1H3,(H,25,30)(H2,24,26,28);1H |
| InChIKey | IDBSHAXYIRSDBN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|