C24H29N7O — CID 111863376
2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111863376) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111863376 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-methyl-1-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(-n2cccn2)cc1)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C24H29N7O/c1-25-24(27-13-11-19-3-9-22(10-4-19)31-15-2-12-29-31)28-17-20-5-7-21(8-6-20)30-16-14-26-23(32)18-30/h2-10,12,15H,11,13-14,16-18H2,1H3,(H,26,32)(H2,25,27,28) |
| InChIKey | DNVWFAIOABKLMJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|