C21H25FN4 — CID 111794118
1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111794118) has the molecular formula C21H25FN4 and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111794118 |
| Molecular Formula | C21H25FN4 |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1ccc(N2CC=CC2)cc1 |
| InChI | InChI=1S/C21H25FN4/c1-23-21(24-13-12-17-4-8-19(22)9-5-17)25-16-18-6-10-20(11-7-18)26-14-2-3-15-26/h2-11H,12-16H2,1H3,(H2,23,24,25) |
| InChIKey | NYLZLAYZVQDZIV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|