C21H23F4N5O — CID 111889235
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine (PubChem CID 111889235) has the molecular formula C21H23F4N5O and a molecular weight of 437.44 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111889235 |
| Molecular Formula | C21H23F4N5O |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(N2CCNC(=O)C2)cc1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C21H23F4N5O/c1-26-20(29-12-15-4-5-16(22)10-18(15)21(23,24)25)28-11-14-2-6-17(7-3-14)30-9-8-27-19(31)13-30/h2-7,10H,8-9,11-13H2,1H3,(H,27,31)(H2,26,28,29) |
| InChIKey | DQTMBLPYNVQNRD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|