C23H30ClFIN5O — CID 111569308
1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111569308) has the molecular formula C23H30ClFIN5O and a molecular weight of 573.88 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111569308 |
| Molecular Formula | C23H30ClFIN5O |
| Molecular Weight | 573.88 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-2-methyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCNC(=O)C2)cc1)NCC(C)(C)c1ccc(F)cc1Cl.I |
| InChI | InChI=1S/C23H29ClFN5O.HI/c1-23(2,19-9-6-17(25)12-20(19)24)15-29-22(26-3)28-13-16-4-7-18(8-5-16)30-11-10-27-21(31)14-30;/h4-9,12H,10-11,13-15H2,1-3H3,(H,27,31)(H2,26,28,29);1H |
| InChIKey | GKECOXYWPLBTTJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|