C20H24ClN3O3 — CID 113213456
N-[2-(4-chlorophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide (PubChem CID 113213456) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113213456 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| SMILES | CC(C)(CNC(=O)N1CCN(C(=O)c2ccco2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O3/c1-20(2,15-5-7-16(21)8-6-15)14-22-19(26)24-11-9-23(10-12-24)18(25)17-4-3-13-27-17/h3-8,13H,9-12,14H2,1-2H3,(H,22,26) |
| InChIKey | HTKJNJBLAYJPMN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |