C17H22ClN3O — CID 48957326
N-[2-(4-chlorophenyl)-2-methylpropyl]-4-cyanopiperidine-1-carboxamide (PubChem CID 48957326) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-methylpropyl]-4-cyanopiperidine-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-4-cyanopiperidine-1-carboxamide |
|---|---|
| PubChem CID | 48957326 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-4-cyanopiperidine-1-carboxamide |
| SMILES | CC(C)(CNC(=O)N1CCC(C#N)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClN3O/c1-17(2,14-3-5-15(18)6-4-14)12-20-16(22)21-9-7-13(11-19)8-10-21/h3-6,13H,7-10,12H2,1-2H3,(H,20,22) |
| InChIKey | ZURHMSHGLPJICH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |