C12H16ClNOS — CID 115167558
N-[2-(4-chlorophenyl)-2-methylpropyl]-2-sulfanylacetamide (PubChem CID 115167558) has the molecular formula C12H16ClNOS and a molecular weight of 257.79 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-methylpropyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167558 |
| Molecular Formula | C12H16ClNOS |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-methylpropyl]-2-sulfanylacetamide |
| SMILES | CC(C)(CNC(=O)CS)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNOS/c1-12(2,8-14-11(15)7-16)9-3-5-10(13)6-4-9/h3-6,16H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | SJIDDDNKUHMZCS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|