C15H23ClN2O — CID 60547202
3-[2-(4-chlorophenyl)-2-methylpropyl]-1,1-diethylurea (PubChem CID 60547202) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-2-methylpropyl]-1,1-diethylurea.
| Compound Name | 3-[2-(4-chlorophenyl)-2-methylpropyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 60547202 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-2-methylpropyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC(C)(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClN2O/c1-5-18(6-2)14(19)17-11-15(3,4)12-7-9-13(16)10-8-12/h7-10H,5-6,11H2,1-4H3,(H,17,19) |
| InChIKey | QHZDYPSVLFZCHQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |