C9H12F3N3O — CID 115598305
4-cyano-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide (PubChem CID 115598305) has the molecular formula C9H12F3N3O and a molecular weight of 235.21 g/mol. Its IUPAC name is 4-cyano-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide.
| Compound Name | 4-cyano-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 115598305 |
| Molecular Formula | C9H12F3N3O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 4-cyano-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
| SMILES | N#CC1CCN(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H12F3N3O/c10-9(11,12)6-14-8(16)15-3-1-7(5-13)2-4-15/h7H,1-4,6H2,(H,14,16) |
| InChIKey | DTDPOUMCDIGYBA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |