C12H21F3N2O — CID 58394886
4-tert-butyl-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide (PubChem CID 58394886) has the molecular formula C12H21F3N2O and a molecular weight of 266.31 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58394886 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-tert-butyl-N-(2,2,2-trifluoroethyl)piperidine-1-carboxamide |
| SMILES | CC(C)(C)C1CCN(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O/c1-11(2,3)9-4-6-17(7-5-9)10(18)16-8-12(13,14)15/h9H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | KBQBKGZLRLJJOG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |