C18H35N3O — CID 118688704
4-tert-butyl-N-[(1-ethylpiperidin-4-yl)methyl]piperidine-1-carboxamide (PubChem CID 118688704) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is 4-tert-butyl-N-[(1-ethylpiperidin-4-yl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-tert-butyl-N-[(1-ethylpiperidin-4-yl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 118688704 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | 4-tert-butyl-N-[(1-ethylpiperidin-4-yl)methyl]piperidine-1-carboxamide |
| SMILES | CCN1CCC(CNC(=O)N2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H35N3O/c1-5-20-10-6-15(7-11-20)14-19-17(22)21-12-8-16(9-13-21)18(2,3)4/h15-16H,5-14H2,1-4H3,(H,19,22) |
| InChIKey | ZMVYTGBZJUGBEU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |