C18H20ClN3O3 — CID 109004660
2-(4-chloro-2-methylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 109004660) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-(4-chloro-2-methylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chloro-2-methylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109004660 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-(4-chloro-2-methylanilino)-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cc(Cl)ccc1NCC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-13-11-14(19)4-5-15(13)20-12-17(23)21-6-8-22(9-7-21)18(24)16-3-2-10-25-16/h2-5,10-11,20H,6-9,12H2,1H3 |
| InChIKey | CPSTVPVXCKJFIU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |