C19H21N3O5 — CID 7824676
[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(furan-2-carbonylamino)acetate (PubChem CID 7824676) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(furan-2-carbonylamino)acetate.
| Compound Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(furan-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 7824676 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(furan-2-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1ccco1)OCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N3O5/c23-17(14-27-18(24)13-20-19(25)16-7-4-12-26-16)22-10-8-21(9-11-22)15-5-2-1-3-6-15/h1-7,12H,8-11,13-14H2,(H,20,25) |
| InChIKey | JIHLPKYIHYCAMI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |