C18H18N2O6 — CID 2388350
[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 2388350) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-hydroxybenzoate.
| Compound Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 2388350 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | O=C(OCC(=O)N1CCN(C(=O)c2ccco2)CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18N2O6/c21-14-5-3-13(4-6-14)18(24)26-12-16(22)19-7-9-20(10-8-19)17(23)15-2-1-11-25-15/h1-6,11,21H,7-10,12H2 |
| InChIKey | XUUGQYUYLNMOCN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |