C20H21N3O6 — CID 8909190
[2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 4-(furan-2-carbonylamino)benzoate (PubChem CID 8909190) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 4-(furan-2-carbonylamino)benzoate.
| Compound Name | [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 4-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 8909190 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 4-(furan-2-carbonylamino)benzoate |
| SMILES | CC(=O)N1CCN(C(=O)COC(=O)c2ccc(NC(=O)c3ccco3)cc2)CC1 |
| InChI | InChI=1S/C20H21N3O6/c1-14(24)22-8-10-23(11-9-22)18(25)13-29-20(27)15-4-6-16(7-5-15)21-19(26)17-3-2-12-28-17/h2-7,12H,8-11,13H2,1H3,(H,21,26) |
| InChIKey | DARVWQDKPUDTLC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |