C17H18N2O5 — CID 2360096
1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(2-hydroxyphenoxy)ethanone (PubChem CID 2360096) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(2-hydroxyphenoxy)ethanone.
| Compound Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(2-hydroxyphenoxy)ethanone |
|---|---|
| PubChem CID | 2360096 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2-(2-hydroxyphenoxy)ethanone |
| SMILES | O=C(COc1ccccc1O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C17H18N2O5/c20-13-4-1-2-5-14(13)24-12-16(21)18-7-9-19(10-8-18)17(22)15-6-3-11-23-15/h1-6,11,20H,7-10,12H2 |
| InChIKey | FIDZJQYCKREBII-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |