C19H17F3N2O5 — CID 2504418
[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 2504418) has the molecular formula C19H17F3N2O5 and a molecular weight of 410.35 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2504418 |
| Molecular Formula | C19H17F3N2O5 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(OCC(=O)N1CCN(C(=O)c2ccco2)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N2O5/c20-19(21,22)14-4-1-3-13(11-14)18(27)29-12-16(25)23-6-8-24(9-7-23)17(26)15-5-2-10-28-15/h1-5,10-11H,6-9,12H2 |
| InChIKey | AUIDBRSUZXVKNT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |