C19H27ClFN3O — CID 126774275
1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1-cyclopentylpiperidin-4-yl)urea (PubChem CID 126774275) has the molecular formula C19H27ClFN3O and a molecular weight of 367.90 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1-cyclopentylpiperidin-4-yl)urea.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1-cyclopentylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126774275 |
| Molecular Formula | C19H27ClFN3O |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(1-cyclopentylpiperidin-4-yl)urea |
| SMILES | CC(NC(=O)NC1CCN(C2CCCC2)CC1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClFN3O/c1-13(14-6-7-18(21)17(20)12-14)22-19(25)23-15-8-10-24(11-9-15)16-4-2-3-5-16/h6-7,12-13,15-16H,2-5,8-11H2,1H3,(H2,22,23,25) |
| InChIKey | PIHVDXQUUPMMHZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |