C20H30ClN2O+ — CID 4995547
2-(4-chlorophenyl)-N-cyclohexyl-2-(4-methylpiperidin-1-ium-1-yl)acetamide (PubChem CID 4995547) has the molecular formula C20H30ClN2O+ and a molecular weight of 349.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-cyclohexyl-2-(4-methylpiperidin-1-ium-1-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-cyclohexyl-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 4995547 |
| Molecular Formula | C20H30ClN2O+ |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-(4-chlorophenyl)-N-cyclohexyl-2-(4-methylpiperidin-1-ium-1-yl)acetamide |
| SMILES | CC1CC[NH+](C(C(=O)NC2CCCCC2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H29ClN2O/c1-15-11-13-23(14-12-15)19(16-7-9-17(21)10-8-16)20(24)22-18-5-3-2-4-6-18/h7-10,15,18-19H,2-6,11-14H2,1H3,(H,22,24)/p+1 |
| InChIKey | JSSDUTBKRSCJAU-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |