C17H20Cl3NO — CID 139938077
5,5-dichloro-3-(4-chlorophenyl)-N-cyclohexylpent-4-enamide (PubChem CID 139938077) has the molecular formula C17H20Cl3NO and a molecular weight of 360.71 g/mol. Its IUPAC name is 5,5-dichloro-3-(4-chlorophenyl)-N-cyclohexylpent-4-enamide.
| Compound Name | 5,5-dichloro-3-(4-chlorophenyl)-N-cyclohexylpent-4-enamide |
|---|---|
| PubChem CID | 139938077 |
| Molecular Formula | C17H20Cl3NO |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 5,5-dichloro-3-(4-chlorophenyl)-N-cyclohexylpent-4-enamide |
| SMILES | O=C(CC(C=C(Cl)Cl)c1ccc(Cl)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C17H20Cl3NO/c18-14-8-6-12(7-9-14)13(10-16(19)20)11-17(22)21-15-4-2-1-3-5-15/h6-10,13,15H,1-5,11H2,(H,21,22) |
| InChIKey | VYHJAHFOHHFXAZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |