C21H24ClNO2 — CID 2952080
3-(5-chloro-2-hydroxyphenyl)-N-cyclohexyl-3-phenylpropanamide (PubChem CID 2952080) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 2952080 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1cc(Cl)ccc1O)NC1CCCCC1 |
| InChI | InChI=1S/C21H24ClNO2/c22-16-11-12-20(24)19(13-16)18(15-7-3-1-4-8-15)14-21(25)23-17-9-5-2-6-10-17/h1,3-4,7-8,11-13,17-18,24H,2,5-6,9-10,14H2,(H,23,25) |
| InChIKey | AUJFZIFWXOSLGQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |