C22H28ClN2O3+ — CID 7160797
(3R)-3-(5-chloro-2-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-phenylpropanamide (PubChem CID 7160797) has the molecular formula C22H28ClN2O3+ and a molecular weight of 403.93 g/mol. Its IUPAC name is (3R)-3-(5-chloro-2-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-phenylpropanamide.
| Compound Name | (3R)-3-(5-chloro-2-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 7160797 |
| Molecular Formula | C22H28ClN2O3+ |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (3R)-3-(5-chloro-2-hydroxyphenyl)-N-(3-morpholin-4-ium-4-ylpropyl)-3-phenylpropanamide |
| SMILES | O=C(C[C@H](c1ccccc1)c1cc(Cl)ccc1O)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H27ClN2O3/c23-18-7-8-21(26)20(15-18)19(17-5-2-1-3-6-17)16-22(27)24-9-4-10-25-11-13-28-14-12-25/h1-3,5-8,15,19,26H,4,9-14,16H2,(H,24,27)/p+1/t19-/m1/s1 |
| InChIKey | RAJZCWMYQBWRSA-LJQANCHMSA-O |
| XLogP | 1.99 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|