C16H25ClN3O4S+ — CID 7477670
2-(4-chloro-N-methylsulfonylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)acetamide (PubChem CID 7477670) has the molecular formula C16H25ClN3O4S+ and a molecular weight of 390.91 g/mol. Its IUPAC name is 2-(4-chloro-N-methylsulfonylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)acetamide.
| Compound Name | 2-(4-chloro-N-methylsulfonylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 7477670 |
| Molecular Formula | C16H25ClN3O4S+ |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-(4-chloro-N-methylsulfonylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCC[NH+]1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClN3O4S/c1-25(22,23)20(15-5-3-14(17)4-6-15)13-16(21)18-7-2-8-19-9-11-24-12-10-19/h3-6H,2,7-13H2,1H3,(H,18,21)/p+1 |
| InChIKey | KICKJWRHNVWRKG-UHFFFAOYSA-O |
| XLogP | -0.47 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|