C15H23FN3O4S+ — CID 7477668
2-(2-fluoro-N-methylsulfonylanilino)-N-(2-morpholin-4-ium-4-ylethyl)acetamide (PubChem CID 7477668) has the molecular formula C15H23FN3O4S+ and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-(2-fluoro-N-methylsulfonylanilino)-N-(2-morpholin-4-ium-4-ylethyl)acetamide.
| Compound Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 7477668 |
| Molecular Formula | C15H23FN3O4S+ |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-(2-fluoro-N-methylsulfonylanilino)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCC[NH+]1CCOCC1)c1ccccc1F |
| InChI | InChI=1S/C15H22FN3O4S/c1-24(21,22)19(14-5-3-2-4-13(14)16)12-15(20)17-6-7-18-8-10-23-11-9-18/h2-5H,6-12H2,1H3,(H,17,20)/p+1 |
| InChIKey | ABQKYSOEZAAFBR-UHFFFAOYSA-O |
| XLogP | -1.38 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |