C18H19Cl2FN2O3S2 — CID 126033516
N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-fluoro-N-methylsulfonylanilino)acetamide (PubChem CID 126033516) has the molecular formula C18H19Cl2FN2O3S2 and a molecular weight of 465.40 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-fluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-fluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126033516 |
| Molecular Formula | C18H19Cl2FN2O3S2 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]-2-(2-fluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCSCc1c(Cl)cccc1Cl)c1ccccc1F |
| InChI | InChI=1S/C18H19Cl2FN2O3S2/c1-28(25,26)23(17-8-3-2-7-16(17)21)11-18(24)22-9-10-27-12-13-14(19)5-4-6-15(13)20/h2-8H,9-12H2,1H3,(H,22,24) |
| InChIKey | SJSHTXBDOAIUJM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|