C15H22Cl2N3OS+ — CID 8669408
1-[(2,4-dichlorophenyl)methyl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 8669408) has the molecular formula C15H22Cl2N3OS+ and a molecular weight of 363.33 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8669408 |
| Molecular Formula | C15H22Cl2N3OS+ |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | S=C(NCCC[NH+]1CCOCC1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2N3OS/c16-13-3-2-12(14(17)10-13)11-19-15(22)18-4-1-5-20-6-8-21-9-7-20/h2-3,10H,1,4-9,11H2,(H2,18,19,22)/p+1 |
| InChIKey | GXSMWVICXAKNOR-UHFFFAOYSA-O |
| XLogP | 1.26 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|