C15H13BrCl2N2S — CID 3823326
1-[(2-bromophenyl)methyl]-3-[(2,4-dichlorophenyl)methyl]thiourea (PubChem CID 3823326) has the molecular formula C15H13BrCl2N2S and a molecular weight of 404.16 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[(2,4-dichlorophenyl)methyl]thiourea.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[(2,4-dichlorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3823326 |
| Molecular Formula | C15H13BrCl2N2S |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[(2,4-dichlorophenyl)methyl]thiourea |
| SMILES | S=C(NCc1ccc(Cl)cc1Cl)NCc1ccccc1Br |
| InChI | InChI=1S/C15H13BrCl2N2S/c16-13-4-2-1-3-10(13)8-19-15(21)20-9-11-5-6-12(17)7-14(11)18/h1-7H,8-9H2,(H2,19,20,21) |
| InChIKey | IMPCHLYPAFMXJH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|