C16H13BrCl2N2OS — CID 46762717
3-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-4-methylbenzamide (PubChem CID 46762717) has the molecular formula C16H13BrCl2N2OS and a molecular weight of 432.17 g/mol. Its IUPAC name is 3-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46762717 |
| Molecular Formula | C16H13BrCl2N2OS |
| Molecular Weight | 432.17 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | 3-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)NCc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C16H13BrCl2N2OS/c1-9-2-3-10(6-13(9)17)15(22)21-16(23)20-8-11-4-5-12(18)7-14(11)19/h2-7H,8H2,1H3,(H2,20,21,22,23) |
| InChIKey | DXDPPIBUWRWYDB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.17 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|