C18H17BrCl2N2O3S — CID 46762788
5-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 46762788) has the molecular formula C18H17BrCl2N2O3S and a molecular weight of 492.22 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 46762788 |
| Molecular Formula | C18H17BrCl2N2O3S |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 489.95 |
| IUPAC Name | 5-bromo-N-[(2,4-dichlorophenyl)methylcarbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17BrCl2N2O3S/c1-25-6-7-26-16-5-3-12(19)8-14(16)17(24)23-18(27)22-10-11-2-4-13(20)9-15(11)21/h2-5,8-9H,6-7,10H2,1H3,(H2,22,23,24,27) |
| InChIKey | JPUKKHGERZOQOE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|