C22H18BrCl2NO2 — CID 46762525
5-bromo-N-[(2,4-dichlorophenyl)methyl]-2-(2-phenylethoxy)benzamide (PubChem CID 46762525) has the molecular formula C22H18BrCl2NO2 and a molecular weight of 479.20 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-dichlorophenyl)methyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[(2,4-dichlorophenyl)methyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 46762525 |
| Molecular Formula | C22H18BrCl2NO2 |
| Molecular Weight | 479.20 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | 5-bromo-N-[(2,4-dichlorophenyl)methyl]-2-(2-phenylethoxy)benzamide |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)c1cc(Br)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C22H18BrCl2NO2/c23-17-7-9-21(28-11-10-15-4-2-1-3-5-15)19(12-17)22(27)26-14-16-6-8-18(24)13-20(16)25/h1-9,12-13H,10-11,14H2,(H,26,27) |
| InChIKey | YMZPEDJCFFJTGA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.20 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |