C16H15BrClNO — CID 47444968
N-[(4-bromo-2-chlorophenyl)methyl]-3-phenylpropanamide (PubChem CID 47444968) has the molecular formula C16H15BrClNO and a molecular weight of 352.66 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-3-phenylpropanamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 47444968 |
| Molecular Formula | C16H15BrClNO |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H15BrClNO/c17-14-8-7-13(15(18)10-14)11-19-16(20)9-6-12-4-2-1-3-5-12/h1-5,7-8,10H,6,9,11H2,(H,19,20) |
| InChIKey | OYWTXHMENGQJQI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |