C10H12BrClN2O2 — CID 110908184
1-[(4-bromo-2-chlorophenyl)methyl]-3-(2-hydroxyethyl)urea (PubChem CID 110908184) has the molecular formula C10H12BrClN2O2 and a molecular weight of 307.58 g/mol. Its IUPAC name is 1-[(4-bromo-2-chlorophenyl)methyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110908184 |
| Molecular Formula | C10H12BrClN2O2 |
| Molecular Weight | 307.58 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 1-[(4-bromo-2-chlorophenyl)methyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)NCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H12BrClN2O2/c11-8-2-1-7(9(12)5-8)6-14-10(16)13-3-4-15/h1-2,5,15H,3-4,6H2,(H2,13,14,16) |
| InChIKey | DHPNTVDEKQPSDD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |